What is the 4-(1-pyrrolidinyl)piperidine dihydrochloride?

4-(1-pyrrolidinyl)piperidine dihydrochloride is , while it's Molecular Formula is C 9 H 18 N 2 *2ClH. Used in Pharmaceutical Synthesis: 4-(1-pyrrolidinyl)piperidine dihydrochloride is used as a precursor in the pharmaceutical industry for the synthesis of various organic compounds and medications. Its structural features make it a valuable building block in the development of new drugs. Used in Medicinal Research: In the field of medicinal research, 4-(1-pyrrolidinyl)piperidine dihydrochloride is utilized as a potential drug candidate for the treatment of conditions such as depression, anxiety, and pain. Its chemical properties and interactions with biological systems are under investigation to understand its therapeutic potential. Used in Chemical Research: 4-(1-pyrrolidinyl)piperidine dihydrochloride is also used in chemical research to explore its reactivity, stability, and other chemical properties. This research contributes to the broader understanding of similar compounds and their applications in various chemical processes. Used in Drug Development: 4-(1-pyrrolidinyl)piperidine dihydrochloride is employed in the development of new medications, where its unique structure and properties may offer novel therapeutic avenues. Researchers are exploring its potential to address unmet medical needs and improve patient outcomes.

What is the CAS number for 4-(1-pyrrolidinyl)piperidine dihydrochloride?

The CAS number of 4-(1-pyrrolidinyl)piperidine dihydrochloride is 4983-39-5.

What is the 4-(1-pyrrolidinyl)piperidine dihydrochloride?

4-(1-pyrrolidinyl)piperidine dihydrochloride is , while it's Molecular Formula is C 9 H 18 N 2 *2ClH. Used in Pharmaceutical Synthesis: 4-(1-pyrrolidinyl)piperidine dihydrochloride is used as a precursor in the pharmaceutical industry for the synthesis of various organic compounds and medications. Its structural features make it a valuable building block in the development of new drugs. Used in Medicinal Research: In the field of medicinal research, 4-(1-pyrrolidinyl)piperidine dihydrochloride is utilized as a potential drug candidate for the treatment of conditions such as depression, anxiety, and pain. Its chemical properties and interactions with biological systems are under investigation to understand its therapeutic potential. Used in Chemical Research: 4-(1-pyrrolidinyl)piperidine dihydrochloride is also used in chemical research to explore its reactivity, stability, and other chemical properties. This research contributes to the broader understanding of similar compounds and their applications in various chemical processes. Used in Drug Development: 4-(1-pyrrolidinyl)piperidine dihydrochloride is employed in the development of new medications, where its unique structure and properties may offer novel therapeutic avenues. Researchers are exploring its potential to address unmet medical needs and improve patient outcomes.

What is the CAS number for 4-(1-pyrrolidinyl)piperidine dihydrochloride?

The CAS number of 4-(1-pyrrolidinyl)piperidine dihydrochloride is 4983-39-5.

4-(1-pyrrolidinyl)piperidine dihydrochloride

4-(1-pyrrolidinyl)piperidine dihydrochloride Good Manufacturer supply High Quality 4983-39-5

Molecular Formula: C₉H₁₈N₂*2ClH
Molecular Weight: 227.177
Melting Point: 335-338 °C
Boiling Point: 300.5°Cat760mmHg
Flash Point: 135.6°C
PSA： 15.27000
Density: g/cm³
LogP: 2.70490

4-(1-pyrrolidinyl)piperidine dihydrochloride(Cas 4983-39-5) Usage

General Description

4-(1-pyrrolidinyl)piperidine dihydrochloride is a chemical compound that consists of a piperidine ring with a pyrrolidinyl group attached to it. The dihydrochloride form indicates that the compound exists as a salt with two molecules of hydrochloric acid. 4-(1-pyrrolidinyl)piperidine dihydrochloride is commonly used as a precursor in the synthesis of pharmaceuticals and other organic compounds. It has been studied for its potential use as a drug to treat conditions such as depression, anxiety, and pain. Additionally, it has been investigated for its potential use in chemical research and in the development of new medications.

InChI:InChI=1/C9H18N2.2ClH/c1-2-8-11(7-1)9-3-5-10-6-4-9;;/h9-10H,1-8H2;2*1H